C21H21FN4O6S — CID 163733118
5-ethyl-2-[[1-[(4-fluorophenyl)methylsulfonyl]piperidin-4-ylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 163733118) has the molecular formula C21H21FN4O6S and a molecular weight of 476.49 g/mol. Its IUPAC name is 5-ethyl-2-[[1-[(4-fluorophenyl)methylsulfonyl]piperidin-4-ylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-ethyl-2-[[1-[(4-fluorophenyl)methylsulfonyl]piperidin-4-ylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 163733118 |
| Molecular Formula | C21H21FN4O6S |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 5-ethyl-2-[[1-[(4-fluorophenyl)methylsulfonyl]piperidin-4-ylidene]amino]oxy-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCc1cc(=O)oc2nc(ON=C3CCN(S(=O)(=O)Cc4ccc(F)cc4)CC3)[nH]c(=O)c12 |
| InChI | InChI=1S/C21H21FN4O6S/c1-2-14-11-17(27)31-20-18(14)19(28)23-21(24-20)32-25-16-7-9-26(10-8-16)33(29,30)12-13-3-5-15(22)6-4-13/h3-6,11H,2,7-10,12H2,1H3,(H,23,24,28) |
| InChIKey | LBHQLOVULDBCPD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|