C20H29NO5 — CID 163733297
3-ethoxypropyl 6-[(2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoate (PubChem CID 163733297) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 3-ethoxypropyl 6-[(2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoate.
| Compound Name | 3-ethoxypropyl 6-[(2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoate |
|---|---|
| PubChem CID | 163733297 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 3-ethoxypropyl 6-[(2R,6S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]hexanoate |
| SMILES | CCOCCCOC(=O)CCCCCN1C(=O)[C@@H]2C3C=CC(C3)[C@@H]2C1=O |
| InChI | InChI=1S/C20H29NO5/c1-2-25-11-6-12-26-16(22)7-4-3-5-10-21-19(23)17-14-8-9-15(13-14)18(17)20(21)24/h8-9,14-15,17-18H,2-7,10-13H2,1H3/t14?,15?,17-,18+ |
| InChIKey | LBLZCMAOHGFIMN-SAJCDORXSA-N |
| XLogP | 2.32 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|