About 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline
4-tert-butyl-2-ethyl-6,7-dimethylquinazoline (PubChem CID 163733345) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline.
Molecular Properties
| Compound Name | 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline |
| PubChem CID | 163733345 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline |
| SMILES | CCc1nc(C(C)(C)C)c2cc(C)c(C)cc2n1 |
| InChI | InChI=1S/C16H22N2/c1-7-14-17-13-9-11(3)10(2)8-12(13)15(18-14)16(4,5)6/h8-9H,7H2,1-6H3 |
| InChIKey | OHZUXHJBQJOUEX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline?
The IUPAC name of 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline (CID 163733345) is 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline.
What is the SMILES notation for 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline?
The canonical SMILES for 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline is CCc1nc(C(C)(C)C)c2cc(C)c(C)cc2n1.
What is the InChIKey of 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline?
The InChIKey is OHZUXHJBQJOUEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2/c1-7-14-17-13-9-11(3)10(2)8-12(13)15(18-14)16(4,5)6/h8-9H,7H2,1-6H3.
What are the key properties of 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline?
4-tert-butyl-2-ethyl-6,7-dimethylquinazoline has a molecular weight of 242.37 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-ethyl-6,7-dimethylquinazoline is sourced from PubChem (CID 163733345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).