C32H41N7O3 — CID 163733929
N-[3-[[4-(3,4-dihydro-1H-[1,4]oxazino[4,3-a]indol-10-yl)pyrimidin-2-yl]amino]-6-[ethyl-[2-(ethylamino)ethyl]amino]-4-methoxy-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enamide (PubChem CID 163733929) has the molecular formula C32H41N7O3 and a molecular weight of 571.73 g/mol. Its IUPAC name is N-[3-[[4-(3,4-dihydro-1H-[1,4]oxazino[4,3-a]indol-10-yl)pyrimidin-2-yl]amino]-6-[ethyl-[2-(ethylamino)ethyl]amino]-4-methoxy-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enamide.
| Compound Name | N-[3-[[4-(3,4-dihydro-1H-[1,4]oxazino[4,3-a]indol-10-yl)pyrimidin-2-yl]amino]-6-[ethyl-[2-(ethylamino)ethyl]amino]-4-methoxy-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163733929 |
| Molecular Formula | C32H41N7O3 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | N-[3-[[4-(3,4-dihydro-1H-[1,4]oxazino[4,3-a]indol-10-yl)pyrimidin-2-yl]amino]-6-[ethyl-[2-(ethylamino)ethyl]amino]-4-methoxy-4-methylcyclohexa-1,5-dien-1-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1=CC(Nc2nccc(-c3c4n(c5ccccc35)CCOC4)n2)C(C)(OC)C=C1N(CC)CCNCC |
| InChI | InChI=1S/C32H41N7O3/c1-6-29(40)35-24-19-28(32(4,41-5)20-26(24)38(8-3)16-15-33-7-2)37-31-34-14-13-23(36-31)30-22-11-9-10-12-25(22)39-17-18-42-21-27(30)39/h6,9-14,19-20,28,33H,1,7-8,15-18,21H2,2-5H3,(H,35,40)(H,34,36,37) |
| InChIKey | LBZCEKAUHIWHIF-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 105.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|