C10H11IN2O3S — CID 163733946
iodo 4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxylate (PubChem CID 163733946) has the molecular formula C10H11IN2O3S and a molecular weight of 366.18 g/mol. Its IUPAC name is iodo 4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxylate.
| Compound Name | iodo 4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 163733946 |
| Molecular Formula | C10H11IN2O3S |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | iodo 4-[(2S)-2-methylpyrrolidine-1-carbonyl]-1,3-thiazole-2-carboxylate |
| SMILES | C[C@H]1CCCN1C(=O)c1csc(C(=O)OI)n1 |
| InChI | InChI=1S/C10H11IN2O3S/c1-6-3-2-4-13(6)9(14)7-5-17-8(12-7)10(15)16-11/h5-6H,2-4H2,1H3/t6-/m0/s1 |
| InChIKey | LBZPSAUEMGEHMO-LURJTMIESA-N |
| XLogP | 2.27 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|