C14H19F3N+ — CID 163734320
7-methyl-3-(3,3,3-trifluoropropyl)-4,5,6,7,8,9-hexahydrocyclohepta[c]pyridin-2-ium (PubChem CID 163734320) has the molecular formula C14H19F3N+ and a molecular weight of 258.31 g/mol. Its IUPAC name is 7-methyl-3-(3,3,3-trifluoropropyl)-4,5,6,7,8,9-hexahydrocyclohepta[c]pyridin-2-ium.
| Compound Name | 7-methyl-3-(3,3,3-trifluoropropyl)-4,5,6,7,8,9-hexahydrocyclohepta[c]pyridin-2-ium |
|---|---|
| PubChem CID | 163734320 |
| Molecular Formula | C14H19F3N+ |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 7-methyl-3-(3,3,3-trifluoropropyl)-4,5,6,7,8,9-hexahydrocyclohepta[c]pyridin-2-ium |
| SMILES | CC1CCC2=C(CC1)CC(CCC(F)(F)F)=[N+]=C2 |
| InChI | InChI=1S/C14H19F3N/c1-10-2-4-11-8-13(6-7-14(15,16)17)18-9-12(11)5-3-10/h9-10H,2-8H2,1H3/q+1 |
| InChIKey | GNXPPKMOXANHQH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|