C25H31N7O — CID 163734758
(E)-1-[7-cyclopentyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-6-yl]-2-methylbut-2-en-1-one (PubChem CID 163734758) has the molecular formula C25H31N7O and a molecular weight of 445.57 g/mol. Its IUPAC name is (E)-1-[7-cyclopentyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-6-yl]-2-methylbut-2-en-1-one.
| Compound Name | (E)-1-[7-cyclopentyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-6-yl]-2-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 163734758 |
| Molecular Formula | C25H31N7O |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (E)-1-[7-cyclopentyl-2-[(5-piperazin-1-yl-2-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-6-yl]-2-methylbut-2-en-1-one |
| SMILES | C/C=C(\C)C(=O)c1cc2cnc(Nc3ccc(N4CCNCC4)cn3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C25H31N7O/c1-3-17(2)23(33)21-14-18-15-28-25(30-24(18)32(21)19-6-4-5-7-19)29-22-9-8-20(16-27-22)31-12-10-26-11-13-31/h3,8-9,14-16,19,26H,4-7,10-13H2,1-2H3,(H,27,28,29,30)/b17-3+ |
| InChIKey | LCQCWHAFRCMLBC-IJUHEHPCSA-N |
| XLogP | 4.24 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|