About 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene
2,5-ditert-butyl-2,3-dimethyl-3H-thiophene (PubChem CID 163736354) has the molecular formula C14H26S
and a molecular weight of 226.43 g/mol. Its IUPAC name is 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene |
| PubChem CID | 163736354 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene |
| SMILES | CC1C=C(C(C)(C)C)SC1(C)C(C)(C)C |
| InChI | InChI=1S/C14H26S/c1-10-9-11(12(2,3)4)15-14(10,8)13(5,6)7/h9-10H,1-8H3 |
| InChIKey | LDYASVRDNIOFGQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene?
The IUPAC name of 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene (CID 163736354) is 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene.
What is the SMILES notation for 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene?
The canonical SMILES for 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene is CC1C=C(C(C)(C)C)SC1(C)C(C)(C)C.
What is the InChIKey of 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene?
The InChIKey is LDYASVRDNIOFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26S/c1-10-9-11(12(2,3)4)15-14(10,8)13(5,6)7/h9-10H,1-8H3.
What are the key properties of 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene?
2,5-ditert-butyl-2,3-dimethyl-3H-thiophene has a molecular weight of 226.43 g/mol, XLogP of 5.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-2,3-dimethyl-3H-thiophene is sourced from PubChem (CID 163736354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).