C19H23FN11O10P — CID 163736654
[(2R,5S)-2-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)-4-hydroxy-5-methoxyoxolan-3-yl] [(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 163736654) has the molecular formula C19H23FN11O10P and a molecular weight of 615.43 g/mol. Its IUPAC name is [(2R,5S)-2-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)-4-hydroxy-5-methoxyoxolan-3-yl] [(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,5S)-2-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)-4-hydroxy-5-methoxyoxolan-3-yl] [(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 163736654 |
| Molecular Formula | C19H23FN11O10P |
| Molecular Weight | 615.43 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | [(2R,5S)-2-(5-amino-7-oxo-6H-triazolo[4,5-d]pyrimidin-3-yl)-4-hydroxy-5-methoxyoxolan-3-yl] [(2R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CO[C@H]1O[C@@H](n2nnc3c(=O)[nH]c(N)nc32)C(OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)C(F)C2O)C1O |
| InChI | InChI=1S/C19H23FN11O10P/c1-37-18-10(33)11(17(40-18)31-14-8(28-29-31)15(34)27-19(22)26-14)41-42(35,36)38-2-5-9(32)6(20)16(39-5)30-4-25-7-12(21)23-3-24-13(7)30/h3-6,9-11,16-18,32-33H,2H2,1H3,(H,35,36)(H2,21,23,24)(H3,22,26,27,34)/t5-,6?,9?,10?,11?,16-,17-,18+/m1/s1 |
| InChIKey | LEEQUFCYGZVWKG-XJTKWCLISA-N |
| XLogP | -2.52 |
| TPSA | 296.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.43 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|