C10H10F3NO2S — CID 163737414
N-(2-ethylcyclohepta-2,6-dien-4-yn-1-yl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 163737414) has the molecular formula C10H10F3NO2S and a molecular weight of 265.26 g/mol. Its IUPAC name is N-(2-ethylcyclohepta-2,6-dien-4-yn-1-yl)-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-(2-ethylcyclohepta-2,6-dien-4-yn-1-yl)-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 163737414 |
| Molecular Formula | C10H10F3NO2S |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | N-(2-ethylcyclohepta-2,6-dien-4-yn-1-yl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCC1=CC#CC=CC1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NO2S/c1-2-8-6-4-3-5-7-9(8)14-17(15,16)10(11,12)13/h5-7,9,14H,2H2,1H3 |
| InChIKey | LEVFMUPZGMAPLK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|