C30H34FNO4 — CID 163737618
(1'S,2'S,3'R,8'R,10'R,13'R)-2'-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-13'-methylspiro[1,3-dioxolane-2,6'-12-oxatricyclo[8.3.2.03,8]pentadecane]-11'-one (PubChem CID 163737618) has the molecular formula C30H34FNO4 and a molecular weight of 491.60 g/mol. Its IUPAC name is (1'S,2'S,3'R,8'R,10'R,13'R)-2'-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-13'-methylspiro[1,3-dioxolane-2,6'-12-oxatricyclo[8.3.2.03,8]pentadecane]-11'-one.
| Compound Name | (1'S,2'S,3'R,8'R,10'R,13'R)-2'-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-13'-methylspiro[1,3-dioxolane-2,6'-12-oxatricyclo[8.3.2.03,8]pentadecane]-11'-one |
|---|---|
| PubChem CID | 163737618 |
| Molecular Formula | C30H34FNO4 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (1'S,2'S,3'R,8'R,10'R,13'R)-2'-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-13'-methylspiro[1,3-dioxolane-2,6'-12-oxatricyclo[8.3.2.03,8]pentadecane]-11'-one |
| SMILES | C[C@H]1OC(=O)[C@@H]2CC[C@H]1[C@@H](/C=C/c1ccc(-c3cccc(F)c3)cn1)[C@@H]1CCC3(C[C@H]1C2)OCCO3 |
| InChI | InChI=1S/C30H34FNO4/c1-19-26-9-6-21(29(33)36-19)15-23-17-30(34-13-14-35-30)12-11-27(23)28(26)10-8-25-7-5-22(18-32-25)20-3-2-4-24(31)16-20/h2-5,7-8,10,16,18-19,21,23,26-28H,6,9,11-15,17H2,1H3/b10-8+/t19-,21-,23-,26-,27-,28-/m1/s1 |
| InChIKey | LEZDPHFYPZDIOZ-JUDJDSJCSA-N |
| XLogP | 6.04 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |