C14H23INO4- — CID 163738304
[(1R)-6-methyliodanuidylcyclohex-3-en-1-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 163738304) has the molecular formula C14H23INO4- and a molecular weight of 396.25 g/mol. Its IUPAC name is [(1R)-6-methyliodanuidylcyclohex-3-en-1-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(1R)-6-methyliodanuidylcyclohex-3-en-1-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 163738304 |
| Molecular Formula | C14H23INO4- |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [(1R)-6-methyliodanuidylcyclohex-3-en-1-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | C[I-]C1CC=CC[C@H]1OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23INO4/c1-14(2,3)20-13(18)16-9-12(17)19-11-8-6-5-7-10(11)15-4/h5-6,10-11H,7-9H2,1-4H3,(H,16,18)/q-1/t10?,11-/m1/s1 |
| InChIKey | WBFXWHDBQJFVSV-RRKGBCIJSA-N |
| XLogP | -1.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|