C32H53NO3 — CID 163738855
(5aR)-9-hydroxy-N-(1-hydroxyethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxamide (PubChem CID 163738855) has the molecular formula C32H53NO3 and a molecular weight of 499.78 g/mol. Its IUPAC name is (5aR)-9-hydroxy-N-(1-hydroxyethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxamide.
| Compound Name | (5aR)-9-hydroxy-N-(1-hydroxyethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxamide |
|---|---|
| PubChem CID | 163738855 |
| Molecular Formula | C32H53NO3 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.40 |
| IUPAC Name | (5aR)-9-hydroxy-N-(1-hydroxyethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxamide |
| SMILES | C=C(C)C1CCC2(C(=O)NC(C)O)CC[C@]3(C)C(CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C32H53NO3/c1-19(2)21-11-16-32(27(36)33-20(3)34)18-17-30(7)22(26(21)32)9-10-24-29(6)14-13-25(35)28(4,5)23(29)12-15-31(24,30)8/h20-26,34-35H,1,9-18H2,2-8H3,(H,33,36)/t20?,21?,22?,23?,24?,25?,26?,29?,30-,31?,32?/m1/s1 |
| InChIKey | LFZXBRZPSDEEQO-SWQCHWECSA-N |
| XLogP | 6.46 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|