C19H15I3O — CID 163739706
1,4-diiodobenzene;(4-iodophenyl)-phenylmethanol (PubChem CID 163739706) has the molecular formula C19H15I3O and a molecular weight of 640.04 g/mol. Its IUPAC name is 1,4-diiodobenzene;(4-iodophenyl)-phenylmethanol.
| Compound Name | 1,4-diiodobenzene;(4-iodophenyl)-phenylmethanol |
|---|---|
| PubChem CID | 163739706 |
| Molecular Formula | C19H15I3O |
| Molecular Weight | 640.04 g/mol |
| Exact Mass | 639.83 |
| IUPAC Name | 1,4-diiodobenzene;(4-iodophenyl)-phenylmethanol |
| SMILES | Ic1ccc(I)cc1.OC(c1ccccc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C13H11IO.C6H4I2/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;7-5-1-2-6(8)4-3-5/h1-9,13,15H;1-4H |
| InChIKey | LGRZYBILDPMXSL-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.04 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|