C31H39BO2 — CID 163740182
2-[4-[4-[4-(cyclohexa-1,5-dien-1-ylmethyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 163740182) has the molecular formula C31H39BO2 and a molecular weight of 454.46 g/mol. Its IUPAC name is 2-[4-[4-[4-(cyclohexa-1,5-dien-1-ylmethyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[4-[4-(cyclohexa-1,5-dien-1-ylmethyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163740182 |
| Molecular Formula | C31H39BO2 |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | 2-[4-[4-[4-(cyclohexa-1,5-dien-1-ylmethyl)cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-dien-1-yl]cyclohexa-1,3-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CC=C(C3=CC=C(C4C=CC(CC5=CCCC=C5)=CC4)CC3)CC2)OC1(C)C |
| InChI | InChI=1S/C31H39BO2/c1-30(2)31(3,4)34-32(33-30)29-20-18-28(19-21-29)27-16-14-26(15-17-27)25-12-10-24(11-13-25)22-23-8-6-5-7-9-23/h6,8-12,14,16,18,20,25H,5,7,13,15,17,19,21-22H2,1-4H3 |
| InChIKey | LHBJGSVPEFMEBH-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|