About 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone
1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone (PubChem CID 163741356) has the molecular formula C30H29N3O2
and a molecular weight of 463.58 g/mol. Its IUPAC name is 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone.
Molecular Properties
| Compound Name | 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone |
| PubChem CID | 163741356 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone |
| SMILES | CNc1ccc(C2(c3ccc(NC)cc3)C=Cc3c(C(C)=O)cc4ccc(NC)cc4c3O2)cc1 |
| InChI | InChI=1S/C30H29N3O2/c1-19(34)27-17-20-5-10-25(33-4)18-28(20)29-26(27)15-16-30(35-29,21-6-11-23(31-2)12-7-21)22-8-13-24(32-3)14-9-22/h5-18,31-33H,1-4H3 |
| InChIKey | LIAJWTZSUSPBDU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|
Analyze 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone?
The IUPAC name of 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone (CID 163741356) is 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone.
What is the SMILES notation for 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone?
The canonical SMILES for 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone is CNc1ccc(C2(c3ccc(NC)cc3)C=Cc3c(C(C)=O)cc4ccc(NC)cc4c3O2)cc1.
What is the InChIKey of 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone?
The InChIKey is LIAJWTZSUSPBDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H29N3O2/c1-19(34)27-17-20-5-10-25(33-4)18-28(20)29-26(27)15-16-30(35-29,21-6-11-23(31-2)12-7-21)22-8-13-24(32-3)14-9-22/h5-18,31-33H,1-4H3.
What are the key properties of 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone?
1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone has a molecular weight of 463.58 g/mol, XLogP of 6.52, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[9-(methylamino)-2,2-bis[4-(methylamino)phenyl]benzo[h]chromen-5-yl]ethanone is sourced from PubChem (CID 163741356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).