C30H42NO4S- — CID 163741367
(Z,3S,8S)-3-hydroxy-4,4,8,12-tetramethyl-15-(2-methyl-1,3-benzothiazol-5-yl)-5-oxo-6-prop-2-enylpentadec-12-enoate (PubChem CID 163741367) has the molecular formula C30H42NO4S- and a molecular weight of 512.74 g/mol. Its IUPAC name is (Z,3S,8S)-3-hydroxy-4,4,8,12-tetramethyl-15-(2-methyl-1,3-benzothiazol-5-yl)-5-oxo-6-prop-2-enylpentadec-12-enoate.
| Compound Name | (Z,3S,8S)-3-hydroxy-4,4,8,12-tetramethyl-15-(2-methyl-1,3-benzothiazol-5-yl)-5-oxo-6-prop-2-enylpentadec-12-enoate |
|---|---|
| PubChem CID | 163741367 |
| Molecular Formula | C30H42NO4S- |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | (Z,3S,8S)-3-hydroxy-4,4,8,12-tetramethyl-15-(2-methyl-1,3-benzothiazol-5-yl)-5-oxo-6-prop-2-enylpentadec-12-enoate |
| SMILES | C=CCC(C[C@@H](C)CCC/C(C)=C\CCc1ccc2sc(C)nc2c1)C(=O)C(C)(C)[C@@H](O)CC(=O)[O-] |
| InChI | InChI=1S/C30H43NO4S/c1-7-10-24(29(35)30(5,6)27(32)19-28(33)34)17-21(3)13-8-11-20(2)12-9-14-23-15-16-26-25(18-23)31-22(4)36-26/h7,12,15-16,18,21,24,27,32H,1,8-11,13-14,17,19H2,2-6H3,(H,33,34)/p-1/b20-12-/t21-,24?,27-/m0/s1 |
| InChIKey | LIAQRZXXZPSEND-MVGNMKJWSA-M |
| XLogP | 5.97 |
| TPSA | 90.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|