C12H15BrN2O2 — CID 163741468
2-bromo-N-methoxy-N-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide (PubChem CID 163741468) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 2-bromo-N-methoxy-N-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide.
| Compound Name | 2-bromo-N-methoxy-N-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide |
|---|---|
| PubChem CID | 163741468 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-bromo-N-methoxy-N-methyl-1,2,3,4-tetrahydroquinoline-4-carboxamide |
| SMILES | CON(C)C(=O)C1CC(Br)Nc2ccccc21 |
| InChI | InChI=1S/C12H15BrN2O2/c1-15(17-2)12(16)9-7-11(13)14-10-6-4-3-5-8(9)10/h3-6,9,11,14H,7H2,1-2H3 |
| InChIKey | LIDMSJIBJIKPQI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|