C21H28O2 — CID 163741956
[1-cyclohexyl-1-(4-prop-2-enylphenyl)ethyl] 2-methylprop-2-enoate (PubChem CID 163741956) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is [1-cyclohexyl-1-(4-prop-2-enylphenyl)ethyl] 2-methylprop-2-enoate.
| Compound Name | [1-cyclohexyl-1-(4-prop-2-enylphenyl)ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163741956 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | [1-cyclohexyl-1-(4-prop-2-enylphenyl)ethyl] 2-methylprop-2-enoate |
| SMILES | C=CCc1ccc(C(C)(OC(=O)C(=C)C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H28O2/c1-5-9-17-12-14-19(15-13-17)21(4,23-20(22)16(2)3)18-10-7-6-8-11-18/h5,12-15,18H,1-2,6-11H2,3-4H3 |
| InChIKey | LINOYQUIQCFRDV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|