C23H21N3O2S — CID 163742246
7-[(5S)-5-methyl-4,7-diazaspiro[2.5]octan-7-yl]-3-thieno[3,2-c]pyridin-2-ylchromen-2-one (PubChem CID 163742246) has the molecular formula C23H21N3O2S and a molecular weight of 403.51 g/mol. Its IUPAC name is 7-[(5S)-5-methyl-4,7-diazaspiro[2.5]octan-7-yl]-3-thieno[3,2-c]pyridin-2-ylchromen-2-one.
| Compound Name | 7-[(5S)-5-methyl-4,7-diazaspiro[2.5]octan-7-yl]-3-thieno[3,2-c]pyridin-2-ylchromen-2-one |
|---|---|
| PubChem CID | 163742246 |
| Molecular Formula | C23H21N3O2S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 7-[(5S)-5-methyl-4,7-diazaspiro[2.5]octan-7-yl]-3-thieno[3,2-c]pyridin-2-ylchromen-2-one |
| SMILES | C[C@H]1CN(c2ccc3cc(-c4cc5cnccc5s4)c(=O)oc3c2)CC2(CC2)N1 |
| InChI | InChI=1S/C23H21N3O2S/c1-14-12-26(13-23(25-14)5-6-23)17-3-2-15-8-18(22(27)28-19(15)10-17)21-9-16-11-24-7-4-20(16)29-21/h2-4,7-11,14,25H,5-6,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | LITVCBPHJIVAQB-AWEZNQCLSA-N |
| XLogP | 4.40 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|