About (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+)
(2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+) (PubChem CID 163742282) has the molecular formula C14H20O4U
and a molecular weight of 490.34 g/mol. Its IUPAC name is (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+).
Molecular Properties
| Compound Name | (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+) |
| PubChem CID | 163742282 |
| Molecular Formula | C14H20O4U |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+) |
| SMILES | COC([CH-]C(O)[C@@H](C)O)CO[CH-]c1ccccc1.[U+2] |
| InChI | InChI=1S/C14H20O4.U/c1-11(15)14(16)8-13(17-2)10-18-9-12-6-4-3-5-7-12;/h3-9,11,13-16H,10H2,1-2H3;/q-2;+2/t11-,13?,14?;/m1./s1 |
| InChIKey | DUVDXFSODOKHTA-WFQRBLMPSA-N |
| XLogP | 1.17 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+)?
The IUPAC name of (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+) (CID 163742282) is (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+).
What is the SMILES notation for (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+)?
The canonical SMILES for (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+) is COC([CH-]C(O)[C@@H](C)O)CO[CH-]c1ccccc1.[U+2].
What is the InChIKey of (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+)?
The InChIKey is DUVDXFSODOKHTA-WFQRBLMPSA-N. The full InChI is InChI=1S/C14H20O4.U/c1-11(15)14(16)8-13(17-2)10-18-9-12-6-4-3-5-7-12;/h3-9,11,13-16H,10H2,1-2H3;/q-2;+2/t11-,13?,14?;/m1./s1.
What are the key properties of (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+)?
(2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+) has a molecular weight of 490.34 g/mol, XLogP of 1.17, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-methoxy-6-(phenylmethoxy)hexane-2,3-diol;uranium(2+) is sourced from PubChem (CID 163742282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).