C8H14FN3O — CID 163743081
1-[(1E,3Z)-4-amino-1-fluorobuta-1,3-dien-2-yl]-3-propylurea (PubChem CID 163743081) has the molecular formula C8H14FN3O and a molecular weight of 187.22 g/mol. Its IUPAC name is 1-[(1E,3Z)-4-amino-1-fluorobuta-1,3-dien-2-yl]-3-propylurea.
| Compound Name | 1-[(1E,3Z)-4-amino-1-fluorobuta-1,3-dien-2-yl]-3-propylurea |
|---|---|
| PubChem CID | 163743081 |
| Molecular Formula | C8H14FN3O |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-[(1E,3Z)-4-amino-1-fluorobuta-1,3-dien-2-yl]-3-propylurea |
| SMILES | CCCNC(=O)NC(/C=C\N)=C/F |
| InChI | InChI=1S/C8H14FN3O/c1-2-5-11-8(13)12-7(6-9)3-4-10/h3-4,6H,2,5,10H2,1H3,(H2,11,12,13)/b4-3-,7-6+ |
| InChIKey | LJLOVVNRFIXDMI-WWVFNRLHSA-N |
| XLogP | 0.98 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|