C15H23F3N4 — CID 163743201
(E)-2-N-[2-(4-amino-3a,6,7,7a-tetrahydro-1H-indol-3-yl)ethyl]-5,5,5-trifluoropent-3-ene-2,3-diamine (PubChem CID 163743201) has the molecular formula C15H23F3N4 and a molecular weight of 316.37 g/mol. Its IUPAC name is (E)-2-N-[2-(4-amino-3a,6,7,7a-tetrahydro-1H-indol-3-yl)ethyl]-5,5,5-trifluoropent-3-ene-2,3-diamine.
| Compound Name | (E)-2-N-[2-(4-amino-3a,6,7,7a-tetrahydro-1H-indol-3-yl)ethyl]-5,5,5-trifluoropent-3-ene-2,3-diamine |
|---|---|
| PubChem CID | 163743201 |
| Molecular Formula | C15H23F3N4 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (E)-2-N-[2-(4-amino-3a,6,7,7a-tetrahydro-1H-indol-3-yl)ethyl]-5,5,5-trifluoropent-3-ene-2,3-diamine |
| SMILES | CC(NCCC1=CNC2CCC=C(N)C12)/C(N)=C\C(F)(F)F |
| InChI | InChI=1S/C15H23F3N4/c1-9(12(20)7-15(16,17)18)21-6-5-10-8-22-13-4-2-3-11(19)14(10)13/h3,7-9,13-14,21-22H,2,4-6,19-20H2,1H3/b12-7+ |
| InChIKey | LJOIINMPPYMZGI-KPKJPENVSA-N |
| XLogP | 1.87 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |