C50H34N3O2Si- — CID 163743859
4-(9,9-diphenyl-2-aza-9-silanuidatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaen-2-yl)-2,6,8-triphenyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole (PubChem CID 163743859) has the molecular formula C50H34N3O2Si- and a molecular weight of 736.93 g/mol. Its IUPAC name is 4-(9,9-diphenyl-2-aza-9-silanuidatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaen-2-yl)-2,6,8-triphenyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole.
| Compound Name | 4-(9,9-diphenyl-2-aza-9-silanuidatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaen-2-yl)-2,6,8-triphenyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 163743859 |
| Molecular Formula | C50H34N3O2Si- |
| Molecular Weight | 736.93 g/mol |
| Exact Mass | 736.24 |
| IUPAC Name | 4-(9,9-diphenyl-2-aza-9-silanuidatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaen-2-yl)-2,6,8-triphenyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
| SMILES | c1ccc(-c2nc3c(N4c5ccccc5[SiH-](c5ccccc5)(c5ccccc5)c5ccccc54)c4oc(-c5ccccc5)nc4c(-c4ccccc4)c3o2)cc1 |
| InChI | InChI=1S/C50H34N3O2Si/c1-6-20-34(21-7-1)43-44-48(55-49(51-44)35-22-8-2-9-23-35)46(45-47(43)54-50(52-45)36-24-10-3-11-25-36)53-39-30-16-18-32-41(39)56(37-26-12-4-13-27-37,38-28-14-5-15-29-38)42-33-19-17-31-40(42)53/h1-33,56H/q-1 |
| InChIKey | LKCOYGLHANCADG-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 55.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.93 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|