C24H21F3N4O4S — CID 163744582
4-[(1R,2S)-1,2-dihydroxy-2-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]ethyl]cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 163744582) has the molecular formula C24H21F3N4O4S and a molecular weight of 518.52 g/mol. Its IUPAC name is 4-[(1R,2S)-1,2-dihydroxy-2-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]ethyl]cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 4-[(1R,2S)-1,2-dihydroxy-2-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]ethyl]cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 163744582 |
| Molecular Formula | C24H21F3N4O4S |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 4-[(1R,2S)-1,2-dihydroxy-2-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-1,3-thiazol-2-yl]ethyl]cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2cnc([C@@H](O)[C@H](O)C3=CCC(C(=O)O)C=C3)s2)c1 |
| InChI | InChI=1S/C24H21F3N4O4S/c1-12-8-15(10-16(9-12)30-23-28-7-6-18(31-23)24(25,26)27)17-11-29-21(36-17)20(33)19(32)13-2-4-14(5-3-13)22(34)35/h2-4,6-11,14,19-20,32-33H,5H2,1H3,(H,34,35)(H,28,30,31)/t14?,19-,20+/m1/s1 |
| InChIKey | LKSRIMVAQSJBGB-LCMMRXEZSA-N |
| XLogP | 4.65 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |