About N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine
N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine (PubChem CID 163745786) has the molecular formula C9H19N3S
and a molecular weight of 201.34 g/mol. Its IUPAC name is N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine.
Molecular Properties
| Compound Name | N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine |
| PubChem CID | 163745786 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine |
| SMILES | CNC1CNC(C2CCCNC2)S1 |
| InChI | InChI=1S/C9H19N3S/c1-10-8-6-12-9(13-8)7-3-2-4-11-5-7/h7-12H,2-6H2,1H3 |
| InChIKey | LLSYPKQVWQUHRD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine?
The IUPAC name of N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine (CID 163745786) is N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine.
What is the SMILES notation for N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine?
The canonical SMILES for N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine is CNC1CNC(C2CCCNC2)S1.
What is the InChIKey of N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine?
The InChIKey is LLSYPKQVWQUHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3S/c1-10-8-6-12-9(13-8)7-3-2-4-11-5-7/h7-12H,2-6H2,1H3.
What are the key properties of N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine?
N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine has a molecular weight of 201.34 g/mol, XLogP of 0.19, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-piperidin-3-yl-1,3-thiazolidin-5-amine is sourced from PubChem (CID 163745786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).