C27H28BN3O2 — CID 163745872
2,4-diphenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydro-1,3,5-triazine (PubChem CID 163745872) has the molecular formula C27H28BN3O2 and a molecular weight of 437.35 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 163745872 |
| Molecular Formula | C27H28BN3O2 |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2,4-diphenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,4-dihydro-1,3,5-triazine |
| SMILES | CC1(C)OB(c2ccc(C3=NC(c4ccccc4)N=C(c4ccccc4)N3)cc2)OC1(C)C |
| InChI | InChI=1S/C27H28BN3O2/c1-26(2)27(3,4)33-28(32-26)22-17-15-21(16-18-22)25-30-23(19-11-7-5-8-12-19)29-24(31-25)20-13-9-6-10-14-20/h5-18,23H,1-4H3,(H,29,30,31) |
| InChIKey | LLUPUWYSMIWMKG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|