C17H24 — CID 163746536
5-ethyl-1,1,2,3,6-pentamethyl-2H-naphthalene (PubChem CID 163746536) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 5-ethyl-1,1,2,3,6-pentamethyl-2H-naphthalene.
| Compound Name | 5-ethyl-1,1,2,3,6-pentamethyl-2H-naphthalene |
|---|---|
| PubChem CID | 163746536 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 5-ethyl-1,1,2,3,6-pentamethyl-2H-naphthalene |
| SMILES | CCc1c(C)ccc2c1C=C(C)C(C)C2(C)C |
| InChI | InChI=1S/C17H24/c1-7-14-11(2)8-9-16-15(14)10-12(3)13(4)17(16,5)6/h8-10,13H,7H2,1-6H3 |
| InChIKey | LMJCFNNVKJZETL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |