C25H23F2N5O2 — CID 163746964
4-[1-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-oxoethyl]-4-(3-fluoro-4-methoxyphenyl)pyrazol-3-yl]-2-fluorobenzonitrile (PubChem CID 163746964) has the molecular formula C25H23F2N5O2 and a molecular weight of 463.49 g/mol. Its IUPAC name is 4-[1-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-oxoethyl]-4-(3-fluoro-4-methoxyphenyl)pyrazol-3-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[1-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-oxoethyl]-4-(3-fluoro-4-methoxyphenyl)pyrazol-3-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 163746964 |
| Molecular Formula | C25H23F2N5O2 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 4-[1-[2-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-2-oxoethyl]-4-(3-fluoro-4-methoxyphenyl)pyrazol-3-yl]-2-fluorobenzonitrile |
| SMILES | COc1ccc(-c2cn(CC(=O)N3CC4CNCC4C3)nc2-c2ccc(C#N)c(F)c2)cc1F |
| InChI | InChI=1S/C25H23F2N5O2/c1-34-23-5-4-15(6-22(23)27)20-13-32(14-24(33)31-11-18-9-29-10-19(18)12-31)30-25(20)16-2-3-17(8-28)21(26)7-16/h2-7,13,18-19,29H,9-12,14H2,1H3 |
| InChIKey | OMAHDLRIJREUFC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |