C22H29N3O2S2 — CID 163747259
N-[3-[4-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-(propan-2-ylamino)propanamide (PubChem CID 163747259) has the molecular formula C22H29N3O2S2 and a molecular weight of 431.63 g/mol. Its IUPAC name is N-[3-[4-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-(propan-2-ylamino)propanamide.
| Compound Name | N-[3-[4-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 163747259 |
| Molecular Formula | C22H29N3O2S2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[3-[4-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-3-(propan-2-ylamino)propanamide |
| SMILES | CC(C)NCCC(=O)Nc1sc2c(c1-c1nc(C3=CCOCC3)cs1)CCCC2 |
| InChI | InChI=1S/C22H29N3O2S2/c1-14(2)23-10-7-19(26)25-22-20(16-5-3-4-6-18(16)29-22)21-24-17(13-28-21)15-8-11-27-12-9-15/h8,13-14,23H,3-7,9-12H2,1-2H3,(H,25,26) |
| InChIKey | HHJQGIVMIWWFLM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |