C10H19N7O — CID 163750011
1-[2-(methylamino)piperazin-1-yl]-4-(2H-tetrazol-5-yl)butan-1-one (PubChem CID 163750011) has the molecular formula C10H19N7O and a molecular weight of 253.31 g/mol. Its IUPAC name is 1-[2-(methylamino)piperazin-1-yl]-4-(2H-tetrazol-5-yl)butan-1-one.
| Compound Name | 1-[2-(methylamino)piperazin-1-yl]-4-(2H-tetrazol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 163750011 |
| Molecular Formula | C10H19N7O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-[2-(methylamino)piperazin-1-yl]-4-(2H-tetrazol-5-yl)butan-1-one |
| SMILES | CNC1CNCCN1C(=O)CCCc1nn[nH]n1 |
| InChI | InChI=1S/C10H19N7O/c1-11-9-7-12-5-6-17(9)10(18)4-2-3-8-13-15-16-14-8/h9,11-12H,2-7H2,1H3,(H,13,14,15,16) |
| InChIKey | LPESEYDCUYWESX-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |