C22H38O2 — CID 163750259
1-[(3S,5aR,7R,9aR,9bS)-7-[(2S)-2-hydroxyhexyl]-3a-methyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]ethanone (PubChem CID 163750259) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 1-[(3S,5aR,7R,9aR,9bS)-7-[(2S)-2-hydroxyhexyl]-3a-methyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]ethanone.
| Compound Name | 1-[(3S,5aR,7R,9aR,9bS)-7-[(2S)-2-hydroxyhexyl]-3a-methyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]ethanone |
|---|---|
| PubChem CID | 163750259 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 1-[(3S,5aR,7R,9aR,9bS)-7-[(2S)-2-hydroxyhexyl]-3a-methyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl]ethanone |
| SMILES | CCCC[C@H](O)C[C@@H]1CC[C@@H]2[C@H](CCC3(C)[C@@H](C(C)=O)CC[C@@H]23)C1 |
| InChI | InChI=1S/C22H38O2/c1-4-5-6-18(24)14-16-7-8-19-17(13-16)11-12-22(3)20(15(2)23)9-10-21(19)22/h16-21,24H,4-14H2,1-3H3/t16-,17-,18+,19-,20-,21+,22?/m1/s1 |
| InChIKey | LPJQRNZCWATRFJ-JOQBXGCJSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |