About 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane
1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane (PubChem CID 163750459) has the molecular formula C17H32N4O
and a molecular weight of 308.47 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane.
Molecular Properties
| Compound Name | 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane |
| PubChem CID | 163750459 |
| Molecular Formula | C17H32N4O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane |
| SMILES | CCn1ccc(C)n1.CCn1nc(C)cc1C.COC(C)C |
| InChI | InChI=1S/C7H12N2.C6H10N2.C4H10O/c1-4-9-7(3)5-6(2)8-9;1-3-8-5-4-6(2)7-8;1-4(2)5-3/h5H,4H2,1-3H3;4-5H,3H2,1-2H3;4H,1-3H3 |
| InChIKey | LPNSRFYZFZEXLC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane?
The IUPAC name of 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane (CID 163750459) is 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane.
What is the SMILES notation for 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane?
The canonical SMILES for 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane is CCn1ccc(C)n1.CCn1nc(C)cc1C.COC(C)C.
What is the InChIKey of 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane?
The InChIKey is LPNSRFYZFZEXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C6H10N2.C4H10O/c1-4-9-7(3)5-6(2)8-9;1-3-8-5-4-6(2)7-8;1-4(2)5-3/h5H,4H2,1-3H3;4-5H,3H2,1-2H3;4H,1-3H3.
What are the key properties of 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane?
1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane has a molecular weight of 308.47 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dimethylpyrazole;1-ethyl-3-methylpyrazole;2-methoxypropane is sourced from PubChem (CID 163750459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).