C54H36N6OS — CID 163750723
2-[4-[3-(4-cyclohexa-1,3-dien-1-yl-6-dibenzofuran-4-yl-1,2-dihydro-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 163750723) has the molecular formula C54H36N6OS and a molecular weight of 816.99 g/mol. Its IUPAC name is 2-[4-[3-(4-cyclohexa-1,3-dien-1-yl-6-dibenzofuran-4-yl-1,2-dihydro-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[3-(4-cyclohexa-1,3-dien-1-yl-6-dibenzofuran-4-yl-1,2-dihydro-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 163750723 |
| Molecular Formula | C54H36N6OS |
| Molecular Weight | 816.99 g/mol |
| Exact Mass | 816.27 |
| IUPAC Name | 2-[4-[3-(4-cyclohexa-1,3-dien-1-yl-6-dibenzofuran-4-yl-1,2-dihydro-1,3,5-triazin-2-yl)dibenzothiophen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C1=CCCC(C2=NC(c3cc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c4c(c3)sc3ccccc34)NC(c3cccc4c3oc3ccccc34)=N2)=C1 |
| InChI | InChI=1S/C54H36N6OS/c1-4-15-34(16-5-1)49-55-50(35-17-6-2-7-18-35)57-52(56-49)37-29-27-33(28-30-37)43-31-38(32-46-47(43)41-22-11-13-26-45(41)62-46)53-58-51(36-19-8-3-9-20-36)59-54(60-53)42-24-14-23-40-39-21-10-12-25-44(39)61-48(40)42/h1-8,10-19,21-32,53H,9,20H2,(H,58,59,60) |
| InChIKey | LPTVOSMZCJWTCU-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 88.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.99 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |