C26H23F3N2O3 — CID 163751118
(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-1-(4-oxopiperidine-1-carbonyl)piperidin-4-one (PubChem CID 163751118) has the molecular formula C26H23F3N2O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is (3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-1-(4-oxopiperidine-1-carbonyl)piperidin-4-one.
| Compound Name | (3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-1-(4-oxopiperidine-1-carbonyl)piperidin-4-one |
|---|---|
| PubChem CID | 163751118 |
| Molecular Formula | C26H23F3N2O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-1-(4-oxopiperidine-1-carbonyl)piperidin-4-one |
| SMILES | Cc1cc(/C=C2\CN(C(=O)N3CCC(=O)CC3)C/C(=C\c3ccc(F)c(F)c3)C2=O)ccc1F |
| InChI | InChI=1S/C26H23F3N2O3/c1-16-10-17(2-4-22(16)27)11-19-14-31(26(34)30-8-6-21(32)7-9-30)15-20(25(19)33)12-18-3-5-23(28)24(29)13-18/h2-5,10-13H,6-9,14-15H2,1H3/b19-11+,20-12+ |
| InChIKey | MKBPWALMFAFZCN-AYKLPDECSA-N |
| XLogP | 4.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|