C22H28N3O+ — CID 163752092
8-[(2R)-2,3-dimethyl-3-propan-2-yl-2H-imidazol-3-ium-1-yl]-2-ethyl-7-methyl-[1]benzofuro[2,3-b]pyridine (PubChem CID 163752092) has the molecular formula C22H28N3O+ and a molecular weight of 350.49 g/mol. Its IUPAC name is 8-[(2R)-2,3-dimethyl-3-propan-2-yl-2H-imidazol-3-ium-1-yl]-2-ethyl-7-methyl-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 8-[(2R)-2,3-dimethyl-3-propan-2-yl-2H-imidazol-3-ium-1-yl]-2-ethyl-7-methyl-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 163752092 |
| Molecular Formula | C22H28N3O+ |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 8-[(2R)-2,3-dimethyl-3-propan-2-yl-2H-imidazol-3-ium-1-yl]-2-ethyl-7-methyl-[1]benzofuro[2,3-b]pyridine |
| SMILES | CCc1ccc2c(n1)oc1c(N3C=C[N+](C)(C(C)C)[C@@H]3C)c(C)ccc12 |
| InChI | InChI=1S/C22H28N3O/c1-7-17-9-11-19-18-10-8-15(4)20(21(18)26-22(19)23-17)24-12-13-25(6,14(2)3)16(24)5/h8-14,16H,7H2,1-6H3/q+1/t16-,25?/m1/s1 |
| InChIKey | BENLITAWPDYRDF-ZRTDVJLTSA-N |
| XLogP | 5.34 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|