C31H34N4O4 — CID 163754764
[4-[bis(prop-2-ynyl)amino]-3,5-dimethylphenyl]-methylcarbamic acid;[2-[bis(prop-2-ynyl)amino]-5-methylphenyl]-methylcarbamic acid (PubChem CID 163754764) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is [4-[bis(prop-2-ynyl)amino]-3,5-dimethylphenyl]-methylcarbamic acid;[2-[bis(prop-2-ynyl)amino]-5-methylphenyl]-methylcarbamic acid.
| Compound Name | [4-[bis(prop-2-ynyl)amino]-3,5-dimethylphenyl]-methylcarbamic acid;[2-[bis(prop-2-ynyl)amino]-5-methylphenyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 163754764 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | [4-[bis(prop-2-ynyl)amino]-3,5-dimethylphenyl]-methylcarbamic acid;[2-[bis(prop-2-ynyl)amino]-5-methylphenyl]-methylcarbamic acid |
| SMILES | C#CCN(CC#C)c1c(C)cc(N(C)C(=O)O)cc1C.C#CCN(CC#C)c1ccc(C)cc1N(C)C(=O)O |
| InChI | InChI=1S/C16H18N2O2.C15H16N2O2/c1-6-8-18(9-7-2)15-12(3)10-14(11-13(15)4)17(5)16(19)20;1-5-9-17(10-6-2)13-8-7-12(3)11-14(13)16(4)15(18)19/h1-2,10-11H,8-9H2,3-5H3,(H,19,20);1-2,7-8,11H,9-10H2,3-4H3,(H,18,19) |
| InChIKey | LTCBWNIUZAPAKM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|