About 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol
6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol (PubChem CID 163755331) has the molecular formula C7H8F3NO
and a molecular weight of 179.14 g/mol. Its IUPAC name is 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol |
| PubChem CID | 163755331 |
| Molecular Formula | C7H8F3NO |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol |
| SMILES | CC1=CC(C(F)(F)F)=CC(O)N1 |
| InChI | InChI=1S/C7H8F3NO/c1-4-2-5(7(8,9)10)3-6(12)11-4/h2-3,6,11-12H,1H3 |
| InChIKey | LTOLJTGOIKPSIA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol?
The IUPAC name of 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol (CID 163755331) is 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol.
What is the SMILES notation for 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol?
The canonical SMILES for 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol is CC1=CC(C(F)(F)F)=CC(O)N1.
What is the InChIKey of 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol?
The InChIKey is LTOLJTGOIKPSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3NO/c1-4-2-5(7(8,9)10)3-6(12)11-4/h2-3,6,11-12H,1H3.
What are the key properties of 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol?
6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol has a molecular weight of 179.14 g/mol, XLogP of 1.30, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-(trifluoromethyl)-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 163755331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).