C34H48N2O6 — CID 163755947
benzyl 2-cyclopropyl-4-[(3S)-4-[[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]methyl]pyrrolidin-3-yl]butanoate (PubChem CID 163755947) has the molecular formula C34H48N2O6 and a molecular weight of 580.77 g/mol. Its IUPAC name is benzyl 2-cyclopropyl-4-[(3S)-4-[[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]methyl]pyrrolidin-3-yl]butanoate.
| Compound Name | benzyl 2-cyclopropyl-4-[(3S)-4-[[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]methyl]pyrrolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 163755947 |
| Molecular Formula | C34H48N2O6 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | benzyl 2-cyclopropyl-4-[(3S)-4-[[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]methyl]pyrrolidin-3-yl]butanoate |
| SMILES | COCCCOc1cc(C(=O)N(CC2CNC[C@H]2CCC(C(=O)OCc2ccccc2)C2CC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C34H48N2O6/c1-24(2)36(33(37)27-14-16-31(40-4)32(19-27)41-18-8-17-39-3)22-29-21-35-20-28(29)13-15-30(26-11-12-26)34(38)42-23-25-9-6-5-7-10-25/h5-7,9-10,14,16,19,24,26,28-30,35H,8,11-13,15,17-18,20-23H2,1-4H3/t28-,29?,30?/m1/s1 |
| InChIKey | LUAHIACWPFSQBP-AYMNYOFFSA-N |
| XLogP | 5.35 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|