C50H28N4U — CID 163756051
3-(3,6-diphenylcarbazol-9-yl)-4-(3-phenyl-4H-carbazol-4-id-9-yl)benzene-1,2-dicarbonitrile;uranium(2+) (PubChem CID 163756051) has the molecular formula C50H28N4U and a molecular weight of 922.83 g/mol. Its IUPAC name is 3-(3,6-diphenylcarbazol-9-yl)-4-(3-phenyl-4H-carbazol-4-id-9-yl)benzene-1,2-dicarbonitrile;uranium(2+).
| Compound Name | 3-(3,6-diphenylcarbazol-9-yl)-4-(3-phenyl-4H-carbazol-4-id-9-yl)benzene-1,2-dicarbonitrile;uranium(2+) |
|---|---|
| PubChem CID | 163756051 |
| Molecular Formula | C50H28N4U |
| Molecular Weight | 922.83 g/mol |
| Exact Mass | 922.28 |
| IUPAC Name | 3-(3,6-diphenylcarbazol-9-yl)-4-(3-phenyl-4H-carbazol-4-id-9-yl)benzene-1,2-dicarbonitrile;uranium(2+) |
| SMILES | N#Cc1ccc(-n2c3ccc(-c4[c-]cccc4)[c-]c3c3ccccc32)c(-n2c3ccc(-c4ccccc4)cc3c3cc(-c4ccccc4)ccc32)c1C#N.[U+2] |
| InChI | InChI=1S/C50H28N4.U/c51-31-39-23-27-49(53-45-19-11-10-18-40(45)41-28-36(20-24-46(41)53)33-12-4-1-5-13-33)50(44(39)32-52)54-47-25-21-37(34-14-6-2-7-15-34)29-42(47)43-30-38(22-26-48(43)54)35-16-8-3-9-17-35;/h1-12,14-27,29-30H;/q-2;+2 |
| InChIKey | OEKWCPYQLBQTNG-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.83 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|