C17H20F3N7 — CID 163756071
9-(1-methylpyrazol-4-yl)-6-piperidin-3-yl-5-(trifluoromethyl)-2,3,7-triazabicyclo[6.1.1]deca-1(9),2,5,7-tetraen-4-amine (PubChem CID 163756071) has the molecular formula C17H20F3N7 and a molecular weight of 379.39 g/mol. Its IUPAC name is 9-(1-methylpyrazol-4-yl)-6-piperidin-3-yl-5-(trifluoromethyl)-2,3,7-triazabicyclo[6.1.1]deca-1(9),2,5,7-tetraen-4-amine.
| Compound Name | 9-(1-methylpyrazol-4-yl)-6-piperidin-3-yl-5-(trifluoromethyl)-2,3,7-triazabicyclo[6.1.1]deca-1(9),2,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 163756071 |
| Molecular Formula | C17H20F3N7 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 9-(1-methylpyrazol-4-yl)-6-piperidin-3-yl-5-(trifluoromethyl)-2,3,7-triazabicyclo[6.1.1]deca-1(9),2,5,7-tetraen-4-amine |
| SMILES | Cn1cc(C2=C3C/C2=N\C(C2CCCNC2)=C(C(F)(F)F)C(N)/N=N\3)cn1 |
| InChI | InChI=1S/C17H20F3N7/c1-27-8-10(7-23-27)13-11-5-12(13)25-26-16(21)14(17(18,19)20)15(24-11)9-3-2-4-22-6-9/h7-9,16,22H,2-6,21H2,1H3/b15-14?,24-11-,26-25- |
| InChIKey | RTLYBCUDEGYNCO-OJVCLCIHSA-N |
| XLogP | 2.54 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |