About N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine
N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine (PubChem CID 163756077) has the molecular formula C8H15FN2
and a molecular weight of 158.22 g/mol. Its IUPAC name is N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine |
| PubChem CID | 163756077 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine |
| SMILES | C=C(F)/C(=C\C)NCCNC |
| InChI | InChI=1S/C8H15FN2/c1-4-8(7(2)9)11-6-5-10-3/h4,10-11H,2,5-6H2,1,3H3/b8-4+ |
| InChIKey | LUDSTFBYTBMRLG-XBXARRHUSA-N |
| XLogP | 1.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine?
The IUPAC name of N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine (CID 163756077) is N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine.
What is the SMILES notation for N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine?
The canonical SMILES for N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine is C=C(F)/C(=C\C)NCCNC.
What is the InChIKey of N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine?
The InChIKey is LUDSTFBYTBMRLG-XBXARRHUSA-N. The full InChI is InChI=1S/C8H15FN2/c1-4-8(7(2)9)11-6-5-10-3/h4,10-11H,2,5-6H2,1,3H3/b8-4+.
What are the key properties of N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine?
N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine has a molecular weight of 158.22 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3E)-2-fluoropenta-1,3-dien-3-yl]-N-methylethane-1,2-diamine is sourced from PubChem (CID 163756077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).