C35H46N3O+ — CID 163758008
[amino(cyclohexen-1-yl)methyl]-[cyclohex-2-en-1-yl-(9-oxapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),3(8),11,17,19-pentaen-18-ylmethylideneamino)methyl]azanium (PubChem CID 163758008) has the molecular formula C35H46N3O+ and a molecular weight of 524.77 g/mol. Its IUPAC name is [amino(cyclohexen-1-yl)methyl]-[cyclohex-2-en-1-yl-(9-oxapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),3(8),11,17,19-pentaen-18-ylmethylideneamino)methyl]azanium.
| Compound Name | [amino(cyclohexen-1-yl)methyl]-[cyclohex-2-en-1-yl-(9-oxapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),3(8),11,17,19-pentaen-18-ylmethylideneamino)methyl]azanium |
|---|---|
| PubChem CID | 163758008 |
| Molecular Formula | C35H46N3O+ |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.36 |
| IUPAC Name | [amino(cyclohexen-1-yl)methyl]-[cyclohex-2-en-1-yl-(9-oxapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),3(8),11,17,19-pentaen-18-ylmethylideneamino)methyl]azanium |
| SMILES | NC([NH2+]C(N=CC1=CC2CCC3=C(C2C=C1)C1C2=C(CCCC2)OC1C=C3)C1C=CCCC1)C1=CCCCC1 |
| InChI | InChI=1S/C35H45N3O/c36-34(25-9-3-1-4-10-25)38-35(26-11-5-2-6-12-26)37-22-23-15-19-28-27(21-23)17-16-24-18-20-31-33(32(24)28)29-13-7-8-14-30(29)39-31/h5,9,11,15,18-22,26-28,31,33-35,38H,1-4,6-8,10,12-14,16-17,36H2/p+1 |
| InChIKey | LVTVJUFMUNFTLC-UHFFFAOYSA-O |
| XLogP | 6.32 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|