C12H15N4O2S- — CID 163758106
3-[N'-(azetidin-3-ylamino)-N-methylidenecarbamimidoyl]-4-methylbenzenesulfinate (PubChem CID 163758106) has the molecular formula C12H15N4O2S- and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-[N'-(azetidin-3-ylamino)-N-methylidenecarbamimidoyl]-4-methylbenzenesulfinate.
| Compound Name | 3-[N'-(azetidin-3-ylamino)-N-methylidenecarbamimidoyl]-4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 163758106 |
| Molecular Formula | C12H15N4O2S- |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-[N'-(azetidin-3-ylamino)-N-methylidenecarbamimidoyl]-4-methylbenzenesulfinate |
| SMILES | C=NC(=NNC1CNC1)c1cc(S(=O)[O-])ccc1C |
| InChI | InChI=1S/C12H16N4O2S/c1-8-3-4-10(19(17)18)5-11(8)12(13-2)16-15-9-6-14-7-9/h3-5,9,14-15H,2,6-7H2,1H3,(H,17,18)/p-1 |
| InChIKey | UMSJKDCYPINPKX-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|