C13H18F3NO2 — CID 163758629
3-hydroxy-3-[(2E,5Z,7S)-8,8,8-trifluoro-7-methylocta-2,5-dien-2-yl]azetidine-1-carbaldehyde (PubChem CID 163758629) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is 3-hydroxy-3-[(2E,5Z,7S)-8,8,8-trifluoro-7-methylocta-2,5-dien-2-yl]azetidine-1-carbaldehyde.
| Compound Name | 3-hydroxy-3-[(2E,5Z,7S)-8,8,8-trifluoro-7-methylocta-2,5-dien-2-yl]azetidine-1-carbaldehyde |
|---|---|
| PubChem CID | 163758629 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-hydroxy-3-[(2E,5Z,7S)-8,8,8-trifluoro-7-methylocta-2,5-dien-2-yl]azetidine-1-carbaldehyde |
| SMILES | C/C(=C\C/C=C\[C@H](C)C(F)(F)F)C1(O)CN(C=O)C1 |
| InChI | InChI=1S/C13H18F3NO2/c1-10(12(19)7-17(8-12)9-18)5-3-4-6-11(2)13(14,15)16/h4-6,9,11,19H,3,7-8H2,1-2H3/b6-4-,10-5+/t11-/m0/s1 |
| InChIKey | LWGCSRPGSSKHPF-UYWQIUBJSA-N |
| XLogP | 2.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|