C10H14N4 — CID 163759001
N,N'-bis(1H-pyrrol-2-yl)ethane-1,2-diamine (PubChem CID 163759001) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is N,N'-bis(1H-pyrrol-2-yl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(1H-pyrrol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 163759001 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N,N'-bis(1H-pyrrol-2-yl)ethane-1,2-diamine |
| SMILES | c1c[nH]c(NCCNc2ccc[nH]2)c1 |
| InChI | InChI=1S/C10H14N4/c1-3-9(11-5-1)13-7-8-14-10-4-2-6-12-10/h1-6,11-14H,7-8H2 |
| InChIKey | LWNWGVHQBMFTBN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|