About CID 163759567
CID 163759567 (PubChem CID 163759567) has the molecular formula C11H13BO4S
and a molecular weight of 252.10 g/mol.
Molecular Properties
| Compound Name | CID 163759567 |
| PubChem CID | 163759567 |
| Molecular Formula | C11H13BO4S |
| Molecular Weight | 252.10 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | — |
| SMILES | [B]Cc1c(CS(C)(=O)=O)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C11H13BO4S/c1-7-9(11(13)14)4-3-8(10(7)5-12)6-17(2,15)16/h3-4H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | IKDZPBPMCAAKCA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.10 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163759567 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163759567?
The IUPAC name of CID 163759567 (CID 163759567) is not available.
What is the SMILES notation for CID 163759567?
The canonical SMILES for CID 163759567 is [B]Cc1c(CS(C)(=O)=O)ccc(C(=O)O)c1C.
What is the InChIKey of CID 163759567?
The InChIKey is IKDZPBPMCAAKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BO4S/c1-7-9(11(13)14)4-3-8(10(7)5-12)6-17(2,15)16/h3-4H,5-6H2,1-2H3,(H,13,14).
What are the key properties of CID 163759567?
CID 163759567 has a molecular weight of 252.10 g/mol, XLogP of 0.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163759567 is sourced from PubChem (CID 163759567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).