C24H26N2O4S — CID 163760303
N-[3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)-4-(3-ethylphenoxy)phenyl]ethenesulfonamide (PubChem CID 163760303) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)-4-(3-ethylphenoxy)phenyl]ethenesulfonamide.
| Compound Name | N-[3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)-4-(3-ethylphenoxy)phenyl]ethenesulfonamide |
|---|---|
| PubChem CID | 163760303 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)-4-(3-ethylphenoxy)phenyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)Nc1ccc(Oc2cccc(CC)c2)c(-c2cc(CC)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C24H26N2O4S/c1-5-17-9-8-10-21(13-17)30-23-12-11-20(25-31(28,29)7-3)15-22(23)19-14-18(6-2)24(27)26(4)16-19/h7-16,25H,3,5-6H2,1-2,4H3 |
| InChIKey | MGFCQKTZZUCTPN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |