About (E)-5-amino-2,3-dimethylpent-3-en-1-ol
(E)-5-amino-2,3-dimethylpent-3-en-1-ol (PubChem CID 163760546) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (E)-5-amino-2,3-dimethylpent-3-en-1-ol.
Molecular Properties
| Compound Name | (E)-5-amino-2,3-dimethylpent-3-en-1-ol |
| PubChem CID | 163760546 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (E)-5-amino-2,3-dimethylpent-3-en-1-ol |
| SMILES | C/C(=C\CN)C(C)CO |
| InChI | InChI=1S/C7H15NO/c1-6(3-4-8)7(2)5-9/h3,7,9H,4-5,8H2,1-2H3/b6-3+ |
| InChIKey | LXULHTVMTAZJHR-ZZXKWVIFSA-N |
| XLogP | 0.52 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-amino-2,3-dimethylpent-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-amino-2,3-dimethylpent-3-en-1-ol?
The IUPAC name of (E)-5-amino-2,3-dimethylpent-3-en-1-ol (CID 163760546) is (E)-5-amino-2,3-dimethylpent-3-en-1-ol.
What is the SMILES notation for (E)-5-amino-2,3-dimethylpent-3-en-1-ol?
The canonical SMILES for (E)-5-amino-2,3-dimethylpent-3-en-1-ol is C/C(=C\CN)C(C)CO.
What is the InChIKey of (E)-5-amino-2,3-dimethylpent-3-en-1-ol?
The InChIKey is LXULHTVMTAZJHR-ZZXKWVIFSA-N. The full InChI is InChI=1S/C7H15NO/c1-6(3-4-8)7(2)5-9/h3,7,9H,4-5,8H2,1-2H3/b6-3+.
What are the key properties of (E)-5-amino-2,3-dimethylpent-3-en-1-ol?
(E)-5-amino-2,3-dimethylpent-3-en-1-ol has a molecular weight of 129.20 g/mol, XLogP of 0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-amino-2,3-dimethylpent-3-en-1-ol is sourced from PubChem (CID 163760546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).