C33H54O3 — CID 163760798
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-oxohexanoate (PubChem CID 163760798) has the molecular formula C33H54O3 and a molecular weight of 498.79 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-oxohexanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-oxohexanoate |
|---|---|
| PubChem CID | 163760798 |
| Molecular Formula | C33H54O3 |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-oxohexanoate |
| SMILES | CCC(=O)CCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C33H54O3/c1-7-25(34)12-16-31(35)36-26-17-19-32(5)24(21-26)11-13-27-29-15-14-28(23(4)10-8-9-22(2)3)33(29,6)20-18-30(27)32/h11,22-23,26-30H,7-10,12-21H2,1-6H3 |
| InChIKey | LXZQEJPGSYSEIX-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|